C22H30 — CID 11087701
1,2-bis(oct-1-ynyl)benzene (PubChem CID 11087701) has the molecular formula C22H30 and a molecular weight of 294.48 g/mol. Its IUPAC name is 1,2-bis(oct-1-ynyl)benzene.
| Compound Name | 1,2-bis(oct-1-ynyl)benzene |
|---|---|
| PubChem CID | 11087701 |
| Molecular Formula | C22H30 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 1,2-bis(oct-1-ynyl)benzene |
| SMILES | CCCCCCC#Cc1ccccc1C#CCCCCCC |
| InChI | InChI=1S/C22H30/c1-3-5-7-9-11-13-17-21-19-15-16-20-22(21)18-14-12-10-8-6-4-2/h15-16,19-20H,3-12H2,1-2H3 |
| InChIKey | QDJWIVMNTSLHNV-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|