C10H22NO7P — CID 11087851
(2S,3R,4S,5R,6R)-2-diethoxyphosphoryl-6-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 11087851) has the molecular formula C10H22NO7P and a molecular weight of 299.26 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-diethoxyphosphoryl-6-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R,6R)-2-diethoxyphosphoryl-6-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 11087851 |
| Molecular Formula | C10H22NO7P |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-diethoxyphosphoryl-6-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | CCOP(=O)(OCC)[C@@H]1N[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H22NO7P/c1-3-17-19(16,18-4-2)10-9(15)8(14)7(13)6(5-12)11-10/h6-15H,3-5H2,1-2H3/t6-,7-,8+,9-,10+/m1/s1 |
| InChIKey | AEJKUMHUZAOBSO-SPFKKGSWSA-N |
| XLogP | -1.37 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|