C15H28O4Si — CID 11087915
methyl (1R,2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxycyclohex-3-ene-1-carboxylate (PubChem CID 11087915) has the molecular formula C15H28O4Si and a molecular weight of 300.47 g/mol. Its IUPAC name is methyl (1R,2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxycyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1R,2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxycyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 11087915 |
| Molecular Formula | C15H28O4Si |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | methyl (1R,2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxycyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](O)C=C[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H28O4Si/c1-15(2,3)20(5,6)19-10-11-7-8-12(16)9-13(11)14(17)18-4/h7-8,11-13,16H,9-10H2,1-6H3/t11-,12-,13-/m1/s1 |
| InChIKey | ZWUSBXVRRPNXLP-JHJVBQTASA-N |
| XLogP | 2.73 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|