C16H18O4S — CID 11088095
(1R,3S,6S,8R,10S)-8-hydroxy-3-methyl-10-(phenylsulfanylmethyl)-2,9-dioxatricyclo[4.3.1.03,8]decan-5-one (PubChem CID 11088095) has the molecular formula C16H18O4S and a molecular weight of 306.38 g/mol. Its IUPAC name is (1R,3S,6S,8R,10S)-8-hydroxy-3-methyl-10-(phenylsulfanylmethyl)-2,9-dioxatricyclo[4.3.1.03,8]decan-5-one.
| Compound Name | (1R,3S,6S,8R,10S)-8-hydroxy-3-methyl-10-(phenylsulfanylmethyl)-2,9-dioxatricyclo[4.3.1.03,8]decan-5-one |
|---|---|
| PubChem CID | 11088095 |
| Molecular Formula | C16H18O4S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | (1R,3S,6S,8R,10S)-8-hydroxy-3-methyl-10-(phenylsulfanylmethyl)-2,9-dioxatricyclo[4.3.1.03,8]decan-5-one |
| SMILES | C[C@]12CC(=O)[C@H]3C[C@@]1(O)O[C@@H](O2)[C@H]3CSc1ccccc1 |
| InChI | InChI=1S/C16H18O4S/c1-15-8-13(17)11-7-16(15,18)20-14(19-15)12(11)9-21-10-5-3-2-4-6-10/h2-6,11-12,14,18H,7-9H2,1H3/t11-,12-,14+,15-,16+/m0/s1 |
| InChIKey | VJWPQUJEPPFPME-LZNONINNSA-N |
| XLogP | 2.21 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |