C14H30N2O3 — CID 110882196
N-tert-butyl-2-[[2-hydroxy-3-[(2-methylpropan-2-yl)oxy]propyl]-methylamino]acetamide (PubChem CID 110882196) has the molecular formula C14H30N2O3 and a molecular weight of 274.40 g/mol. Its IUPAC name is N-tert-butyl-2-[[2-hydroxy-3-[(2-methylpropan-2-yl)oxy]propyl]-methylamino]acetamide.
| Compound Name | N-tert-butyl-2-[[2-hydroxy-3-[(2-methylpropan-2-yl)oxy]propyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 110882196 |
| Molecular Formula | C14H30N2O3 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | N-tert-butyl-2-[[2-hydroxy-3-[(2-methylpropan-2-yl)oxy]propyl]-methylamino]acetamide |
| SMILES | CN(CC(=O)NC(C)(C)C)CC(O)COC(C)(C)C |
| InChI | InChI=1S/C14H30N2O3/c1-13(2,3)15-12(18)9-16(7)8-11(17)10-19-14(4,5)6/h11,17H,8-10H2,1-7H3,(H,15,18) |
| InChIKey | VJHPQIACELFYPZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |