C16H13N3O2S — CID 11088225
6-[(E)-3,4-dihydro-2H-naphthalen-1-ylidenemethyl]-5-nitroimidazo[2,1-b][1,3]thiazole (PubChem CID 11088225) has the molecular formula C16H13N3O2S and a molecular weight of 311.37 g/mol. Its IUPAC name is 6-[(E)-3,4-dihydro-2H-naphthalen-1-ylidenemethyl]-5-nitroimidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-[(E)-3,4-dihydro-2H-naphthalen-1-ylidenemethyl]-5-nitroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 11088225 |
| Molecular Formula | C16H13N3O2S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 6-[(E)-3,4-dihydro-2H-naphthalen-1-ylidenemethyl]-5-nitroimidazo[2,1-b][1,3]thiazole |
| SMILES | O=[N+]([O-])c1c(/C=C2\CCCc3ccccc32)nc2sccn12 |
| InChI | InChI=1S/C16H13N3O2S/c20-19(21)15-14(17-16-18(15)8-9-22-16)10-12-6-3-5-11-4-1-2-7-13(11)12/h1-2,4,7-10H,3,5-6H2/b12-10+ |
| InChIKey | UYIQDNKKKJJZNI-ZRDIBKRKSA-N |
| XLogP | 4.18 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|