C15H22N4O2S — CID 110882929
3-[[4-(furan-2-ylmethyl)-5-piperidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]propan-1-ol (PubChem CID 110882929) has the molecular formula C15H22N4O2S and a molecular weight of 322.43 g/mol. Its IUPAC name is 3-[[4-(furan-2-ylmethyl)-5-piperidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]propan-1-ol.
| Compound Name | 3-[[4-(furan-2-ylmethyl)-5-piperidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 110882929 |
| Molecular Formula | C15H22N4O2S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 3-[[4-(furan-2-ylmethyl)-5-piperidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]propan-1-ol |
| SMILES | OCCCSc1nnc(N2CCCCC2)n1Cc1ccco1 |
| InChI | InChI=1S/C15H22N4O2S/c20-9-5-11-22-15-17-16-14(18-7-2-1-3-8-18)19(15)12-13-6-4-10-21-13/h4,6,10,20H,1-3,5,7-9,11-12H2 |
| InChIKey | XGDKUEUASLPDKS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 67.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|