C19H19F2N3O — CID 110883509
1-(4-fluorophenyl)-2-[[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]amino]ethanol (PubChem CID 110883509) has the molecular formula C19H19F2N3O and a molecular weight of 343.38 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-[[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]amino]ethanol.
| Compound Name | 1-(4-fluorophenyl)-2-[[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]amino]ethanol |
|---|---|
| PubChem CID | 110883509 |
| Molecular Formula | C19H19F2N3O |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 1-(4-fluorophenyl)-2-[[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]amino]ethanol |
| SMILES | Cn1ccnc1C(NCC(O)c1ccc(F)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C19H19F2N3O/c1-24-10-9-22-19(24)18(14-3-2-4-16(21)11-14)23-12-17(25)13-5-7-15(20)8-6-13/h2-11,17-18,23,25H,12H2,1H3 |
| InChIKey | LFYPKSQBLMQSQT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |