C17H24N2O3 — CID 110884052
N-[3-(4-hydroxypiperidine-1-carbonyl)phenyl]-2,2-dimethylpropanamide (PubChem CID 110884052) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-[3-(4-hydroxypiperidine-1-carbonyl)phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[3-(4-hydroxypiperidine-1-carbonyl)phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 110884052 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N-[3-(4-hydroxypiperidine-1-carbonyl)phenyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1cccc(C(=O)N2CCC(O)CC2)c1 |
| InChI | InChI=1S/C17H24N2O3/c1-17(2,3)16(22)18-13-6-4-5-12(11-13)15(21)19-9-7-14(20)8-10-19/h4-6,11,14,20H,7-10H2,1-3H3,(H,18,22) |
| InChIKey | BJZAFOPVMJOXFN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |