C13H21IN4 — CID 110884525
2-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide (PubChem CID 110884525) has the molecular formula C13H21IN4 and a molecular weight of 360.24 g/mol. Its IUPAC name is 2-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110884525 |
| Molecular Formula | C13H21IN4 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 2-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide |
| SMILES | I.NC(N)=NCC(c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C13H20N4.HI/c14-13(15)16-10-12(17-8-4-5-9-17)11-6-2-1-3-7-11;/h1-3,6-7,12H,4-5,8-10H2,(H4,14,15,16);1H |
| InChIKey | XTVZWBOZKXHVSR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|