About 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-(3,4-difluorophenyl)ethanol
2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-(3,4-difluorophenyl)ethanol (PubChem CID 110884908) has the molecular formula C14H16F2N4OS
and a molecular weight of 326.37 g/mol. Its IUPAC name is 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-(3,4-difluorophenyl)ethanol.
Molecular Properties
| Compound Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-(3,4-difluorophenyl)ethanol |
| PubChem CID | 110884908 |
| Molecular Formula | C14H16F2N4OS |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-(3,4-difluorophenyl)ethanol |
| SMILES | OC(CSc1nnnn1C1CCCC1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H16F2N4OS/c15-11-6-5-9(7-12(11)16)13(21)8-22-14-17-18-19-20(14)10-3-1-2-4-10/h5-7,10,13,21H,1-4,8H2 |
| InChIKey | DEYUMYJMHGDNFO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-(3,4-difluorophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-(3,4-difluorophenyl)ethanol?
The IUPAC name of 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-(3,4-difluorophenyl)ethanol (CID 110884908) is 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-(3,4-difluorophenyl)ethanol.
What is the SMILES notation for 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-(3,4-difluorophenyl)ethanol?
The canonical SMILES for 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-(3,4-difluorophenyl)ethanol is OC(CSc1nnnn1C1CCCC1)c1ccc(F)c(F)c1.
What is the InChIKey of 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-(3,4-difluorophenyl)ethanol?
The InChIKey is DEYUMYJMHGDNFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F2N4OS/c15-11-6-5-9(7-12(11)16)13(21)8-22-14-17-18-19-20(14)10-3-1-2-4-10/h5-7,10,13,21H,1-4,8H2.
What are the key properties of 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-(3,4-difluorophenyl)ethanol?
2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-(3,4-difluorophenyl)ethanol has a molecular weight of 326.37 g/mol, XLogP of 2.89, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-(3,4-difluorophenyl)ethanol is sourced from PubChem (CID 110884908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).