C18H17ClFNO2 — CID 110885515
N-[2-(4-chlorophenyl)-2-hydroxyethyl]-2-(2-fluorophenyl)cyclopropane-1-carboxamide (PubChem CID 110885515) has the molecular formula C18H17ClFNO2 and a molecular weight of 333.79 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-2-hydroxyethyl]-2-(2-fluorophenyl)cyclopropane-1-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)-2-hydroxyethyl]-2-(2-fluorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 110885515 |
| Molecular Formula | C18H17ClFNO2 |
| Molecular Weight | 333.79 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | N-[2-(4-chlorophenyl)-2-hydroxyethyl]-2-(2-fluorophenyl)cyclopropane-1-carboxamide |
| SMILES | O=C(NCC(O)c1ccc(Cl)cc1)C1CC1c1ccccc1F |
| InChI | InChI=1S/C18H17ClFNO2/c19-12-7-5-11(6-8-12)17(22)10-21-18(23)15-9-14(15)13-3-1-2-4-16(13)20/h1-8,14-15,17,22H,9-10H2,(H,21,23) |
| InChIKey | LDZYBSLOLGYFLI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.79 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |