C16H18O5S — CID 11088560
(1S,12S,14R)-9-methoxy-4,4-dioxo-11-oxa-4lambda6-thiatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol (PubChem CID 11088560) has the molecular formula C16H18O5S and a molecular weight of 322.38 g/mol. Its IUPAC name is (1S,12S,14R)-9-methoxy-4,4-dioxo-11-oxa-4lambda6-thiatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol.
| Compound Name | (1S,12S,14R)-9-methoxy-4,4-dioxo-11-oxa-4lambda6-thiatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol |
|---|---|
| PubChem CID | 11088560 |
| Molecular Formula | C16H18O5S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | (1S,12S,14R)-9-methoxy-4,4-dioxo-11-oxa-4lambda6-thiatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol |
| SMILES | COc1ccc2c3c1O[C@H]1C[C@@H](O)C=C[C@@]31CCS(=O)(=O)C2 |
| InChI | InChI=1S/C16H18O5S/c1-20-12-3-2-10-9-22(18,19)7-6-16-5-4-11(17)8-13(16)21-15(12)14(10)16/h2-5,11,13,17H,6-9H2,1H3/t11-,13-,16-/m0/s1 |
| InChIKey | QQTMZVLILHBXAT-RBOXIYTFSA-N |
| XLogP | 1.33 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|