C18H26O5 — CID 11088564
[(4S,8'aS)-5',5',8'a-trimethyl-2-oxospiro[1,3-dioxolane-4,1'-4a,6,7,8-tetrahydro-4H-naphthalene]-2'-yl]methyl acetate (PubChem CID 11088564) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is [(4S,8'aS)-5',5',8'a-trimethyl-2-oxospiro[1,3-dioxolane-4,1'-4a,6,7,8-tetrahydro-4H-naphthalene]-2'-yl]methyl acetate.
| Compound Name | [(4S,8'aS)-5',5',8'a-trimethyl-2-oxospiro[1,3-dioxolane-4,1'-4a,6,7,8-tetrahydro-4H-naphthalene]-2'-yl]methyl acetate |
|---|---|
| PubChem CID | 11088564 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | [(4S,8'aS)-5',5',8'a-trimethyl-2-oxospiro[1,3-dioxolane-4,1'-4a,6,7,8-tetrahydro-4H-naphthalene]-2'-yl]methyl acetate |
| SMILES | CC(=O)OCC1=CCC2C(C)(C)CCC[C@]2(C)[C@@]12COC(=O)O2 |
| InChI | InChI=1S/C18H26O5/c1-12(19)21-10-13-6-7-14-16(2,3)8-5-9-17(14,4)18(13)11-22-15(20)23-18/h6,14H,5,7-11H2,1-4H3/t14?,17-,18+/m0/s1 |
| InChIKey | CADGFVZTAODBII-CXRLMVSZSA-N |
| XLogP | 3.62 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|