C19H34O2Si — CID 11088582
(1S,3S,4R)-4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3,5-dimethylbicyclo[2.2.2]oct-5-en-2-one (PubChem CID 11088582) has the molecular formula C19H34O2Si and a molecular weight of 322.57 g/mol. Its IUPAC name is (1S,3S,4R)-4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3,5-dimethylbicyclo[2.2.2]oct-5-en-2-one.
| Compound Name | (1S,3S,4R)-4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3,5-dimethylbicyclo[2.2.2]oct-5-en-2-one |
|---|---|
| PubChem CID | 11088582 |
| Molecular Formula | C19H34O2Si |
| Molecular Weight | 322.57 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (1S,3S,4R)-4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3,5-dimethylbicyclo[2.2.2]oct-5-en-2-one |
| SMILES | CC1=C[C@@H]2CC[C@@]1(CCCO[Si](C)(C)C(C)(C)C)[C@H](C)C2=O |
| InChI | InChI=1S/C19H34O2Si/c1-14-13-16-9-11-19(14,15(2)17(16)20)10-8-12-21-22(6,7)18(3,4)5/h13,15-16H,8-12H2,1-7H3/t15-,16+,19-/m1/s1 |
| InChIKey | HHMKIRXJIORDMQ-JTDSTZFVSA-N |
| XLogP | 5.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.57 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|