C20H24N2O2 — CID 11088635
methyl (8R,13E,14S,16S,17S,18S)-13-ethylidene-1,11-diazapentacyclo[12.3.1.02,7.08,17.011,16]octadeca-2,4,6-triene-18-carboxylate (PubChem CID 11088635) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is methyl (8R,13E,14S,16S,17S,18S)-13-ethylidene-1,11-diazapentacyclo[12.3.1.02,7.08,17.011,16]octadeca-2,4,6-triene-18-carboxylate.
| Compound Name | methyl (8R,13E,14S,16S,17S,18S)-13-ethylidene-1,11-diazapentacyclo[12.3.1.02,7.08,17.011,16]octadeca-2,4,6-triene-18-carboxylate |
|---|---|
| PubChem CID | 11088635 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | methyl (8R,13E,14S,16S,17S,18S)-13-ethylidene-1,11-diazapentacyclo[12.3.1.02,7.08,17.011,16]octadeca-2,4,6-triene-18-carboxylate |
| SMILES | C/C=C1/CN2CC[C@@H]3c4ccccc4N4[C@@H]3[C@@H]2C[C@@H]1[C@H]4C(=O)OC |
| InChI | InChI=1S/C20H24N2O2/c1-3-12-11-21-9-8-14-13-6-4-5-7-16(13)22-18(14)17(21)10-15(12)19(22)20(23)24-2/h3-7,14-15,17-19H,8-11H2,1-2H3/b12-3-/t14-,15+,17+,18+,19+/m1/s1 |
| InChIKey | NDMCSKPJAMKSOO-INWQSEFJSA-N |
| XLogP | 2.55 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|