C18H22FN3O2 — CID 110886741
[5-ethyl-1-(4-fluorophenyl)pyrazol-4-yl]-[3-(hydroxymethyl)piperidin-1-yl]methanone (PubChem CID 110886741) has the molecular formula C18H22FN3O2 and a molecular weight of 331.39 g/mol. Its IUPAC name is [5-ethyl-1-(4-fluorophenyl)pyrazol-4-yl]-[3-(hydroxymethyl)piperidin-1-yl]methanone.
| Compound Name | [5-ethyl-1-(4-fluorophenyl)pyrazol-4-yl]-[3-(hydroxymethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 110886741 |
| Molecular Formula | C18H22FN3O2 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | [5-ethyl-1-(4-fluorophenyl)pyrazol-4-yl]-[3-(hydroxymethyl)piperidin-1-yl]methanone |
| SMILES | CCc1c(C(=O)N2CCCC(CO)C2)cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H22FN3O2/c1-2-17-16(18(24)21-9-3-4-13(11-21)12-23)10-20-22(17)15-7-5-14(19)6-8-15/h5-8,10,13,23H,2-4,9,11-12H2,1H3 |
| InChIKey | GBGJSYNQZYINFK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |