C16H16FNO2 — CID 110888195
2-(2,3-dihydro-1,4-benzoxazin-4-yl)-1-(2-fluorophenyl)ethanol (PubChem CID 110888195) has the molecular formula C16H16FNO2 and a molecular weight of 273.31 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzoxazin-4-yl)-1-(2-fluorophenyl)ethanol.
| Compound Name | 2-(2,3-dihydro-1,4-benzoxazin-4-yl)-1-(2-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 110888195 |
| Molecular Formula | C16H16FNO2 |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzoxazin-4-yl)-1-(2-fluorophenyl)ethanol |
| SMILES | OC(CN1CCOc2ccccc21)c1ccccc1F |
| InChI | InChI=1S/C16H16FNO2/c17-13-6-2-1-5-12(13)15(19)11-18-9-10-20-16-8-4-3-7-14(16)18/h1-8,15,19H,9-11H2 |
| InChIKey | MHOGNUGPNVOZKJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |