C18H21NO5 — CID 11088854
(3R)-3-hydroxy-4-(4-methoxyphenoxy)-N-phenylmethoxybutanamide (PubChem CID 11088854) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is (3R)-3-hydroxy-4-(4-methoxyphenoxy)-N-phenylmethoxybutanamide.
| Compound Name | (3R)-3-hydroxy-4-(4-methoxyphenoxy)-N-phenylmethoxybutanamide |
|---|---|
| PubChem CID | 11088854 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | (3R)-3-hydroxy-4-(4-methoxyphenoxy)-N-phenylmethoxybutanamide |
| SMILES | COc1ccc(OC[C@H](O)CC(=O)NOCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H21NO5/c1-22-16-7-9-17(10-8-16)23-13-15(20)11-18(21)19-24-12-14-5-3-2-4-6-14/h2-10,15,20H,11-13H2,1H3,(H,19,21)/t15-/m1/s1 |
| InChIKey | GDUOOMMRAUUBJN-OAHLLOKOSA-N |
| XLogP | 2.07 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|