C20H34O2Si — CID 11088951
(2E,6Z)-8-[tert-butyl(dimethyl)silyl]oxy-4,4,7-trimethylundeca-2,6-dien-10-ynal (PubChem CID 11088951) has the molecular formula C20H34O2Si and a molecular weight of 334.58 g/mol. Its IUPAC name is (2E,6Z)-8-[tert-butyl(dimethyl)silyl]oxy-4,4,7-trimethylundeca-2,6-dien-10-ynal.
| Compound Name | (2E,6Z)-8-[tert-butyl(dimethyl)silyl]oxy-4,4,7-trimethylundeca-2,6-dien-10-ynal |
|---|---|
| PubChem CID | 11088951 |
| Molecular Formula | C20H34O2Si |
| Molecular Weight | 334.58 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | (2E,6Z)-8-[tert-butyl(dimethyl)silyl]oxy-4,4,7-trimethylundeca-2,6-dien-10-ynal |
| SMILES | C#CCC(O[Si](C)(C)C(C)(C)C)/C(C)=C\CC(C)(C)/C=C/C=O |
| InChI | InChI=1S/C20H34O2Si/c1-10-12-18(22-23(8,9)19(3,4)5)17(2)13-15-20(6,7)14-11-16-21/h1,11,13-14,16,18H,12,15H2,2-9H3/b14-11+,17-13- |
| InChIKey | PCUDBNXOQWLWHS-COPNHUPCSA-N |
| XLogP | 5.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.58 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|