About ethyl 3-[[(R)-tert-butylsulfinyl]amino]-2,2-difluoro-3-(1,3-thiazol-2-yl)propanoate
ethyl 3-[[(R)-tert-butylsulfinyl]amino]-2,2-difluoro-3-(1,3-thiazol-2-yl)propanoate (PubChem CID 11089097) has the molecular formula C12H18F2N2O3S2
and a molecular weight of 340.42 g/mol. Its IUPAC name is ethyl 3-[[(R)-tert-butylsulfinyl]amino]-2,2-difluoro-3-(1,3-thiazol-2-yl)propanoate.
Molecular Properties
| Compound Name | ethyl 3-[[(R)-tert-butylsulfinyl]amino]-2,2-difluoro-3-(1,3-thiazol-2-yl)propanoate |
| PubChem CID | 11089097 |
| Molecular Formula | C12H18F2N2O3S2 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | ethyl 3-[[(R)-tert-butylsulfinyl]amino]-2,2-difluoro-3-(1,3-thiazol-2-yl)propanoate |
| SMILES | CCOC(=O)C(F)(F)C(N[S@](=O)C(C)(C)C)c1nccs1 |
| InChI | InChI=1S/C12H18F2N2O3S2/c1-5-19-10(17)12(13,14)8(9-15-6-7-20-9)16-21(18)11(2,3)4/h6-8,16H,5H2,1-4H3/t8?,21-/m1/s1 |
| InChIKey | BFLUJHGKBSYQSE-XACQXKTJSA-N |
| XLogP | 2.43 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 3-[[(R)-tert-butylsulfinyl]amino]-2,2-difluoro-3-(1,3-thiazol-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[[(R)-tert-butylsulfinyl]amino]-2,2-difluoro-3-(1,3-thiazol-2-yl)propanoate?
The IUPAC name of ethyl 3-[[(R)-tert-butylsulfinyl]amino]-2,2-difluoro-3-(1,3-thiazol-2-yl)propanoate (CID 11089097) is ethyl 3-[[(R)-tert-butylsulfinyl]amino]-2,2-difluoro-3-(1,3-thiazol-2-yl)propanoate.
What is the SMILES notation for ethyl 3-[[(R)-tert-butylsulfinyl]amino]-2,2-difluoro-3-(1,3-thiazol-2-yl)propanoate?
The canonical SMILES for ethyl 3-[[(R)-tert-butylsulfinyl]amino]-2,2-difluoro-3-(1,3-thiazol-2-yl)propanoate is CCOC(=O)C(F)(F)C(N[S@](=O)C(C)(C)C)c1nccs1.
What is the InChIKey of ethyl 3-[[(R)-tert-butylsulfinyl]amino]-2,2-difluoro-3-(1,3-thiazol-2-yl)propanoate?
The InChIKey is BFLUJHGKBSYQSE-XACQXKTJSA-N. The full InChI is InChI=1S/C12H18F2N2O3S2/c1-5-19-10(17)12(13,14)8(9-15-6-7-20-9)16-21(18)11(2,3)4/h6-8,16H,5H2,1-4H3/t8?,21-/m1/s1.
What are the key properties of ethyl 3-[[(R)-tert-butylsulfinyl]amino]-2,2-difluoro-3-(1,3-thiazol-2-yl)propanoate?
ethyl 3-[[(R)-tert-butylsulfinyl]amino]-2,2-difluoro-3-(1,3-thiazol-2-yl)propanoate has a molecular weight of 340.42 g/mol, XLogP of 2.43, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[[(R)-tert-butylsulfinyl]amino]-2,2-difluoro-3-(1,3-thiazol-2-yl)propanoate is sourced from PubChem (CID 11089097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).