C15H21F3N2O — CID 110891512
1-phenyl-2-[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]ethanol (PubChem CID 110891512) has the molecular formula C15H21F3N2O and a molecular weight of 302.34 g/mol. Its IUPAC name is 1-phenyl-2-[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]ethanol.
| Compound Name | 1-phenyl-2-[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]ethanol |
|---|---|
| PubChem CID | 110891512 |
| Molecular Formula | C15H21F3N2O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 1-phenyl-2-[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]ethanol |
| SMILES | OC(CN1CCCN(CC(F)(F)F)CC1)c1ccccc1 |
| InChI | InChI=1S/C15H21F3N2O/c16-15(17,18)12-20-8-4-7-19(9-10-20)11-14(21)13-5-2-1-3-6-13/h1-3,5-6,14,21H,4,7-12H2 |
| InChIKey | AZDOLFQPQPHJKV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |