C12H17IN4O — CID 110893074
2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 110893074) has the molecular formula C12H17IN4O and a molecular weight of 360.20 g/mol. Its IUPAC name is 2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110893074 |
| Molecular Formula | C12H17IN4O |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 2-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | I.NC(N)=NCc1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C12H16N4O.HI/c13-12(14)15-8-9-3-5-10(6-4-9)16-7-1-2-11(16)17;/h3-6H,1-2,7-8H2,(H4,13,14,15);1H |
| InChIKey | LYDRKVCOFXZJCL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|