About (4-bromo-2,6-dimethoxyphenoxy)-tert-butyl-dimethylsilane
(4-bromo-2,6-dimethoxyphenoxy)-tert-butyl-dimethylsilane (PubChem CID 11089314) has the molecular formula C14H23BrO3Si
and a molecular weight of 347.33 g/mol. Its IUPAC name is (4-bromo-2,6-dimethoxyphenoxy)-tert-butyl-dimethylsilane.
Molecular Properties
| Compound Name | (4-bromo-2,6-dimethoxyphenoxy)-tert-butyl-dimethylsilane |
| PubChem CID | 11089314 |
| Molecular Formula | C14H23BrO3Si |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | (4-bromo-2,6-dimethoxyphenoxy)-tert-butyl-dimethylsilane |
| SMILES | COc1cc(Br)cc(OC)c1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H23BrO3Si/c1-14(2,3)19(6,7)18-13-11(16-4)8-10(15)9-12(13)17-5/h8-9H,1-7H3 |
| InChIKey | DAUJPVNIOHHCPY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-bromo-2,6-dimethoxyphenoxy)-tert-butyl-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-2,6-dimethoxyphenoxy)-tert-butyl-dimethylsilane?
The IUPAC name of (4-bromo-2,6-dimethoxyphenoxy)-tert-butyl-dimethylsilane (CID 11089314) is (4-bromo-2,6-dimethoxyphenoxy)-tert-butyl-dimethylsilane.
What is the SMILES notation for (4-bromo-2,6-dimethoxyphenoxy)-tert-butyl-dimethylsilane?
The canonical SMILES for (4-bromo-2,6-dimethoxyphenoxy)-tert-butyl-dimethylsilane is COc1cc(Br)cc(OC)c1O[Si](C)(C)C(C)(C)C.
What is the InChIKey of (4-bromo-2,6-dimethoxyphenoxy)-tert-butyl-dimethylsilane?
The InChIKey is DAUJPVNIOHHCPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23BrO3Si/c1-14(2,3)19(6,7)18-13-11(16-4)8-10(15)9-12(13)17-5/h8-9H,1-7H3.
What are the key properties of (4-bromo-2,6-dimethoxyphenoxy)-tert-butyl-dimethylsilane?
(4-bromo-2,6-dimethoxyphenoxy)-tert-butyl-dimethylsilane has a molecular weight of 347.33 g/mol, XLogP of 4.85, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-2,6-dimethoxyphenoxy)-tert-butyl-dimethylsilane is sourced from PubChem (CID 11089314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).