C21H18O5 — CID 11089416
[(1R,3S)-8-hydroxy-3-methyl-7,12-dioxo-1,2,3,4-tetrahydrobenzo[a]anthracen-1-yl] acetate (PubChem CID 11089416) has the molecular formula C21H18O5 and a molecular weight of 350.37 g/mol. Its IUPAC name is [(1R,3S)-8-hydroxy-3-methyl-7,12-dioxo-1,2,3,4-tetrahydrobenzo[a]anthracen-1-yl] acetate.
| Compound Name | [(1R,3S)-8-hydroxy-3-methyl-7,12-dioxo-1,2,3,4-tetrahydrobenzo[a]anthracen-1-yl] acetate |
|---|---|
| PubChem CID | 11089416 |
| Molecular Formula | C21H18O5 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | [(1R,3S)-8-hydroxy-3-methyl-7,12-dioxo-1,2,3,4-tetrahydrobenzo[a]anthracen-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H](C)Cc2ccc3c(c21)C(=O)c1cccc(O)c1C3=O |
| InChI | InChI=1S/C21H18O5/c1-10-8-12-6-7-14-19(17(12)16(9-10)26-11(2)22)21(25)13-4-3-5-15(23)18(13)20(14)24/h3-7,10,16,23H,8-9H2,1-2H3/t10-,16+/m0/s1 |
| InChIKey | KSKJTAHVEDSQIT-MGPLVRAMSA-N |
| XLogP | 3.35 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|