About methyl (Z)-4,4,4-trifluoro-3-[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]oxybut-2-enoate
methyl (Z)-4,4,4-trifluoro-3-[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]oxybut-2-enoate (PubChem CID 11089554) has the molecular formula C14H11F6NO3
and a molecular weight of 355.23 g/mol. Its IUPAC name is methyl (Z)-4,4,4-trifluoro-3-[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]oxybut-2-enoate.
Molecular Properties
| Compound Name | methyl (Z)-4,4,4-trifluoro-3-[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]oxybut-2-enoate |
| PubChem CID | 11089554 |
| Molecular Formula | C14H11F6NO3 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | methyl (Z)-4,4,4-trifluoro-3-[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]oxybut-2-enoate |
| SMILES | COC(=O)/C=C(\O/N=C(\C)c1ccc(C(F)(F)F)cc1)C(F)(F)F |
| InChI | InChI=1S/C14H11F6NO3/c1-8(9-3-5-10(6-4-9)13(15,16)17)21-24-11(14(18,19)20)7-12(22)23-2/h3-7H,1-2H3/b11-7-,21-8+ |
| InChIKey | IINJOWQETUCWIQ-WAQANLESSA-N |
| XLogP | 4.07 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl (Z)-4,4,4-trifluoro-3-[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]oxybut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (Z)-4,4,4-trifluoro-3-[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]oxybut-2-enoate?
The IUPAC name of methyl (Z)-4,4,4-trifluoro-3-[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]oxybut-2-enoate (CID 11089554) is methyl (Z)-4,4,4-trifluoro-3-[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]oxybut-2-enoate.
What is the SMILES notation for methyl (Z)-4,4,4-trifluoro-3-[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]oxybut-2-enoate?
The canonical SMILES for methyl (Z)-4,4,4-trifluoro-3-[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]oxybut-2-enoate is COC(=O)/C=C(\O/N=C(\C)c1ccc(C(F)(F)F)cc1)C(F)(F)F.
What is the InChIKey of methyl (Z)-4,4,4-trifluoro-3-[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]oxybut-2-enoate?
The InChIKey is IINJOWQETUCWIQ-WAQANLESSA-N. The full InChI is InChI=1S/C14H11F6NO3/c1-8(9-3-5-10(6-4-9)13(15,16)17)21-24-11(14(18,19)20)7-12(22)23-2/h3-7H,1-2H3/b11-7-,21-8+.
What are the key properties of methyl (Z)-4,4,4-trifluoro-3-[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]oxybut-2-enoate?
methyl (Z)-4,4,4-trifluoro-3-[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]oxybut-2-enoate has a molecular weight of 355.23 g/mol, XLogP of 4.07, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z)-4,4,4-trifluoro-3-[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]oxybut-2-enoate is sourced from PubChem (CID 11089554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).