C17H19F2NO5 — CID 11089557
diethyl 2-[[(3S)-7,8-difluoro-3-methyl-2,3-dihydro-1,4-benzoxazin-4-yl]methylidene]propanedioate (PubChem CID 11089557) has the molecular formula C17H19F2NO5 and a molecular weight of 355.34 g/mol. Its IUPAC name is diethyl 2-[[(3S)-7,8-difluoro-3-methyl-2,3-dihydro-1,4-benzoxazin-4-yl]methylidene]propanedioate.
| Compound Name | diethyl 2-[[(3S)-7,8-difluoro-3-methyl-2,3-dihydro-1,4-benzoxazin-4-yl]methylidene]propanedioate |
|---|---|
| PubChem CID | 11089557 |
| Molecular Formula | C17H19F2NO5 |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | diethyl 2-[[(3S)-7,8-difluoro-3-methyl-2,3-dihydro-1,4-benzoxazin-4-yl]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CN1c2ccc(F)c(F)c2OC[C@@H]1C)C(=O)OCC |
| InChI | InChI=1S/C17H19F2NO5/c1-4-23-16(21)11(17(22)24-5-2)8-20-10(3)9-25-15-13(20)7-6-12(18)14(15)19/h6-8,10H,4-5,9H2,1-3H3/t10-/m0/s1 |
| InChIKey | WKJZEEFYXOHIMG-JTQLQIEISA-N |
| XLogP | 2.56 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|