C18H24N4O2 — CID 110896144
1-benzyl-3-[[2-(dimethylamino)-4-pyridinyl]methyl]-1-(2-hydroxyethyl)urea (PubChem CID 110896144) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 1-benzyl-3-[[2-(dimethylamino)-4-pyridinyl]methyl]-1-(2-hydroxyethyl)urea.
| Compound Name | 1-benzyl-3-[[2-(dimethylamino)-4-pyridinyl]methyl]-1-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 110896144 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 1-benzyl-3-[[2-(dimethylamino)-4-pyridinyl]methyl]-1-(2-hydroxyethyl)urea |
| SMILES | CN(C)c1cc(CNC(=O)N(CCO)Cc2ccccc2)ccn1 |
| InChI | InChI=1S/C18H24N4O2/c1-21(2)17-12-16(8-9-19-17)13-20-18(24)22(10-11-23)14-15-6-4-3-5-7-15/h3-9,12,23H,10-11,13-14H2,1-2H3,(H,20,24) |
| InChIKey | APWRAGQBTRIFPG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |