C15H19N3O2 — CID 110896566
N-[1-(4-cyanophenyl)ethyl]-3-hydroxypiperidine-1-carboxamide (PubChem CID 110896566) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is N-[1-(4-cyanophenyl)ethyl]-3-hydroxypiperidine-1-carboxamide.
| Compound Name | N-[1-(4-cyanophenyl)ethyl]-3-hydroxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 110896566 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | N-[1-(4-cyanophenyl)ethyl]-3-hydroxypiperidine-1-carboxamide |
| SMILES | CC(NC(=O)N1CCCC(O)C1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C15H19N3O2/c1-11(13-6-4-12(9-16)5-7-13)17-15(20)18-8-2-3-14(19)10-18/h4-7,11,14,19H,2-3,8,10H2,1H3,(H,17,20) |
| InChIKey | GBVKDZOBXFKGOE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |