C21H28O5 — CID 11089697
methyl (5S,8R,9S,10R,13R,14S)-8,13-dimethyl-1,7,16-trioxo-3,4,5,6,9,11,12,14,15,17-decahydro-2H-cyclopenta[a]phenanthrene-10-carboxylate (PubChem CID 11089697) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is methyl (5S,8R,9S,10R,13R,14S)-8,13-dimethyl-1,7,16-trioxo-3,4,5,6,9,11,12,14,15,17-decahydro-2H-cyclopenta[a]phenanthrene-10-carboxylate.
| Compound Name | methyl (5S,8R,9S,10R,13R,14S)-8,13-dimethyl-1,7,16-trioxo-3,4,5,6,9,11,12,14,15,17-decahydro-2H-cyclopenta[a]phenanthrene-10-carboxylate |
|---|---|
| PubChem CID | 11089697 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | methyl (5S,8R,9S,10R,13R,14S)-8,13-dimethyl-1,7,16-trioxo-3,4,5,6,9,11,12,14,15,17-decahydro-2H-cyclopenta[a]phenanthrene-10-carboxylate |
| SMILES | COC(=O)[C@]12C(=O)CCC[C@H]1CC(=O)[C@]1(C)[C@H]3CC(=O)C[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C21H28O5/c1-19-8-7-14-20(2,15(19)10-13(22)11-19)17(24)9-12-5-4-6-16(23)21(12,14)18(25)26-3/h12,14-15H,4-11H2,1-3H3/t12-,14-,15-,19+,20-,21+/m0/s1 |
| InChIKey | VJSRQYJZJTWDBS-VBOLQVBTSA-N |
| XLogP | 2.89 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|