C13H20INOSi — CID 11089724
5-iodo-2,6,6-trimethyl-1-trimethylsilyloxycyclohexa-2,4-diene-1-carbonitrile (PubChem CID 11089724) has the molecular formula C13H20INOSi and a molecular weight of 361.30 g/mol. Its IUPAC name is 5-iodo-2,6,6-trimethyl-1-trimethylsilyloxycyclohexa-2,4-diene-1-carbonitrile.
| Compound Name | 5-iodo-2,6,6-trimethyl-1-trimethylsilyloxycyclohexa-2,4-diene-1-carbonitrile |
|---|---|
| PubChem CID | 11089724 |
| Molecular Formula | C13H20INOSi |
| Molecular Weight | 361.30 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 5-iodo-2,6,6-trimethyl-1-trimethylsilyloxycyclohexa-2,4-diene-1-carbonitrile |
| SMILES | CC1=CC=C(I)C(C)(C)C1(C#N)O[Si](C)(C)C |
| InChI | InChI=1S/C13H20INOSi/c1-10-7-8-11(14)12(2,3)13(10,9-15)16-17(4,5)6/h7-8H,1-6H3 |
| InChIKey | HFSZVXNOJFXCID-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.30 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|