About 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-6-nitrobenzo[de]isoquinoline-1,3-dione
2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-6-nitrobenzo[de]isoquinoline-1,3-dione (PubChem CID 1108975) has the molecular formula C23H16N4O4
and a molecular weight of 412.41 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-6-nitrobenzo[de]isoquinoline-1,3-dione.
Molecular Properties
| Compound Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-6-nitrobenzo[de]isoquinoline-1,3-dione |
| PubChem CID | 1108975 |
| Molecular Formula | C23H16N4O4 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-6-nitrobenzo[de]isoquinoline-1,3-dione |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1N1C(=O)c2cccc3c([N+](=O)[O-])ccc(c23)C1=O |
| InChI | InChI=1S/C23H16N4O4/c1-13-21(14(2)26(24-13)15-7-4-3-5-8-15)25-22(28)17-10-6-9-16-19(27(30)31)12-11-18(20(16)17)23(25)29/h3-12H,1-2H3 |
| InChIKey | QYYVFKNWWUWKOP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-6-nitrobenzo[de]isoquinoline-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-6-nitrobenzo[de]isoquinoline-1,3-dione?
The IUPAC name of 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-6-nitrobenzo[de]isoquinoline-1,3-dione (CID 1108975) is 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-6-nitrobenzo[de]isoquinoline-1,3-dione.
What is the SMILES notation for 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-6-nitrobenzo[de]isoquinoline-1,3-dione?
The canonical SMILES for 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-6-nitrobenzo[de]isoquinoline-1,3-dione is Cc1nn(-c2ccccc2)c(C)c1N1C(=O)c2cccc3c([N+](=O)[O-])ccc(c23)C1=O.
What is the InChIKey of 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-6-nitrobenzo[de]isoquinoline-1,3-dione?
The InChIKey is QYYVFKNWWUWKOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16N4O4/c1-13-21(14(2)26(24-13)15-7-4-3-5-8-15)25-22(28)17-10-6-9-16-19(27(30)31)12-11-18(20(16)17)23(25)29/h3-12H,1-2H3.
What are the key properties of 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-6-nitrobenzo[de]isoquinoline-1,3-dione?
2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-6-nitrobenzo[de]isoquinoline-1,3-dione has a molecular weight of 412.41 g/mol, XLogP of 4.35, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-6-nitrobenzo[de]isoquinoline-1,3-dione is sourced from PubChem (CID 1108975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).