C21H30O5 — CID 11089761
[(1S,5E)-5-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-1-[(Z)-oct-2-enyl]-4-oxocyclopent-2-en-1-yl] acetate (PubChem CID 11089761) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is [(1S,5E)-5-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-1-[(Z)-oct-2-enyl]-4-oxocyclopent-2-en-1-yl] acetate.
| Compound Name | [(1S,5E)-5-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-1-[(Z)-oct-2-enyl]-4-oxocyclopent-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 11089761 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | [(1S,5E)-5-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-1-[(Z)-oct-2-enyl]-4-oxocyclopent-2-en-1-yl] acetate |
| SMILES | CCCCC/C=C\C[C@]1(OC(C)=O)C=CC(=O)/C1=C/[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C21H30O5/c1-5-6-7-8-9-10-12-21(25-16(2)22)13-11-19(23)18(21)14-17-15-24-20(3,4)26-17/h9-11,13-14,17H,5-8,12,15H2,1-4H3/b10-9-,18-14-/t17-,21-/m0/s1 |
| InChIKey | ZPDXSZSAMUJPSB-SFECJZLLSA-N |
| XLogP | 4.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|