C19H16N2O6 — CID 11089908
(1R,5S,8S,9R)-9-(4-nitrophenyl)-5-phenyl-3,10,11-trioxa-6-azatricyclo[6.2.1.01,6]undecan-7-one (PubChem CID 11089908) has the molecular formula C19H16N2O6 and a molecular weight of 368.35 g/mol. Its IUPAC name is (1R,5S,8S,9R)-9-(4-nitrophenyl)-5-phenyl-3,10,11-trioxa-6-azatricyclo[6.2.1.01,6]undecan-7-one.
| Compound Name | (1R,5S,8S,9R)-9-(4-nitrophenyl)-5-phenyl-3,10,11-trioxa-6-azatricyclo[6.2.1.01,6]undecan-7-one |
|---|---|
| PubChem CID | 11089908 |
| Molecular Formula | C19H16N2O6 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | (1R,5S,8S,9R)-9-(4-nitrophenyl)-5-phenyl-3,10,11-trioxa-6-azatricyclo[6.2.1.01,6]undecan-7-one |
| SMILES | O=C1[C@H]2O[C@@]3(COC[C@H](c4ccccc4)N13)O[C@@H]2c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H16N2O6/c22-18-17-16(13-6-8-14(9-7-13)21(23)24)26-19(27-17)11-25-10-15(20(18)19)12-4-2-1-3-5-12/h1-9,15-17H,10-11H2/t15-,16-,17+,19-/m1/s1 |
| InChIKey | ASYLRALSQHUGNY-VXIBKDFQSA-N |
| XLogP | 2.32 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|