C15H19N5O2S — CID 110899349
12-[[4-(hydroxymethyl)piperidin-1-yl]methyl]-8-methyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one (PubChem CID 110899349) has the molecular formula C15H19N5O2S and a molecular weight of 333.42 g/mol. Its IUPAC name is 12-[[4-(hydroxymethyl)piperidin-1-yl]methyl]-8-methyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one.
| Compound Name | 12-[[4-(hydroxymethyl)piperidin-1-yl]methyl]-8-methyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
|---|---|
| PubChem CID | 110899349 |
| Molecular Formula | C15H19N5O2S |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 12-[[4-(hydroxymethyl)piperidin-1-yl]methyl]-8-methyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
| SMILES | Cn1c(=O)c2sccc2n2c(CN3CCC(CO)CC3)nnc12 |
| InChI | InChI=1S/C15H19N5O2S/c1-18-14(22)13-11(4-7-23-13)20-12(16-17-15(18)20)8-19-5-2-10(9-21)3-6-19/h4,7,10,21H,2-3,5-6,8-9H2,1H3 |
| InChIKey | QVMTYIWBROSPFD-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 75.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |