C16H19FN2O — CID 110899499
1-(2-fluorophenyl)-2-[2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]ethanol (PubChem CID 110899499) has the molecular formula C16H19FN2O and a molecular weight of 274.34 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-2-[2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]ethanol.
| Compound Name | 1-(2-fluorophenyl)-2-[2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]ethanol |
|---|---|
| PubChem CID | 110899499 |
| Molecular Formula | C16H19FN2O |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 1-(2-fluorophenyl)-2-[2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]ethanol |
| SMILES | OC(CN1CCCC1c1ccc[nH]1)c1ccccc1F |
| InChI | InChI=1S/C16H19FN2O/c17-13-6-2-1-5-12(13)16(20)11-19-10-4-8-15(19)14-7-3-9-18-14/h1-3,5-7,9,15-16,18,20H,4,8,10-11H2 |
| InChIKey | VXBXQPIQRVWTHO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |