C17H26N2O7 — CID 11089986
diethyl (3aS,5S,6aS)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3a,4,6,6a-tetrahydrocyclopenta[d][1,2]oxazole-3,5-dicarboxylate (PubChem CID 11089986) has the molecular formula C17H26N2O7 and a molecular weight of 370.40 g/mol. Its IUPAC name is diethyl (3aS,5S,6aS)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3a,4,6,6a-tetrahydrocyclopenta[d][1,2]oxazole-3,5-dicarboxylate.
| Compound Name | diethyl (3aS,5S,6aS)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3a,4,6,6a-tetrahydrocyclopenta[d][1,2]oxazole-3,5-dicarboxylate |
|---|---|
| PubChem CID | 11089986 |
| Molecular Formula | C17H26N2O7 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | diethyl (3aS,5S,6aS)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3a,4,6,6a-tetrahydrocyclopenta[d][1,2]oxazole-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=NO[C@H]2C[C@](NC(=O)OC(C)(C)C)(C(=O)OCC)C[C@@H]12 |
| InChI | InChI=1S/C17H26N2O7/c1-6-23-13(20)12-10-8-17(14(21)24-7-2,9-11(10)26-19-12)18-15(22)25-16(3,4)5/h10-11H,6-9H2,1-5H3,(H,18,22)/t10-,11+,17+/m1/s1 |
| InChIKey | BLMCZUABVPXPIF-RLFDGXBXSA-N |
| XLogP | 1.54 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|