C19H36O5Si — CID 11090046
diethyl 2-but-3-enyl-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]propanedioate (PubChem CID 11090046) has the molecular formula C19H36O5Si and a molecular weight of 372.58 g/mol. Its IUPAC name is diethyl 2-but-3-enyl-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]propanedioate.
| Compound Name | diethyl 2-but-3-enyl-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]propanedioate |
|---|---|
| PubChem CID | 11090046 |
| Molecular Formula | C19H36O5Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | diethyl 2-but-3-enyl-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]propanedioate |
| SMILES | C=CCCC(CCO[Si](C)(C)C(C)(C)C)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C19H36O5Si/c1-9-12-13-19(16(20)22-10-2,17(21)23-11-3)14-15-24-25(7,8)18(4,5)6/h9H,1,10-15H2,2-8H3 |
| InChIKey | VGVGYIJSWSQOCT-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|