C17H27NO3 — CID 110900484
1-(oxolan-2-ylmethoxy)-3-(N,2,3-trimethylanilino)propan-2-ol (PubChem CID 110900484) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-(oxolan-2-ylmethoxy)-3-(N,2,3-trimethylanilino)propan-2-ol.
| Compound Name | 1-(oxolan-2-ylmethoxy)-3-(N,2,3-trimethylanilino)propan-2-ol |
|---|---|
| PubChem CID | 110900484 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 1-(oxolan-2-ylmethoxy)-3-(N,2,3-trimethylanilino)propan-2-ol |
| SMILES | Cc1cccc(N(C)CC(O)COCC2CCCO2)c1C |
| InChI | InChI=1S/C17H27NO3/c1-13-6-4-8-17(14(13)2)18(3)10-15(19)11-20-12-16-7-5-9-21-16/h4,6,8,15-16,19H,5,7,9-12H2,1-3H3 |
| InChIKey | XWUBPZXGTFWZKF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |