About 3-(diphenylphosphorylmethyl)-1-prop-2-enyl-2,3-dihydroindole
3-(diphenylphosphorylmethyl)-1-prop-2-enyl-2,3-dihydroindole (PubChem CID 11090057) has the molecular formula C24H24NOP
and a molecular weight of 373.44 g/mol. Its IUPAC name is 3-(diphenylphosphorylmethyl)-1-prop-2-enyl-2,3-dihydroindole.
Molecular Properties
| Compound Name | 3-(diphenylphosphorylmethyl)-1-prop-2-enyl-2,3-dihydroindole |
| PubChem CID | 11090057 |
| Molecular Formula | C24H24NOP |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 3-(diphenylphosphorylmethyl)-1-prop-2-enyl-2,3-dihydroindole |
| SMILES | C=CCN1CC(CP(=O)(c2ccccc2)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C24H24NOP/c1-2-17-25-18-20(23-15-9-10-16-24(23)25)19-27(26,21-11-5-3-6-12-21)22-13-7-4-8-14-22/h2-16,20H,1,17-19H2 |
| InChIKey | USZJAUYINREPHX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-(diphenylphosphorylmethyl)-1-prop-2-enyl-2,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(diphenylphosphorylmethyl)-1-prop-2-enyl-2,3-dihydroindole?
The IUPAC name of 3-(diphenylphosphorylmethyl)-1-prop-2-enyl-2,3-dihydroindole (CID 11090057) is 3-(diphenylphosphorylmethyl)-1-prop-2-enyl-2,3-dihydroindole.
What is the SMILES notation for 3-(diphenylphosphorylmethyl)-1-prop-2-enyl-2,3-dihydroindole?
The canonical SMILES for 3-(diphenylphosphorylmethyl)-1-prop-2-enyl-2,3-dihydroindole is C=CCN1CC(CP(=O)(c2ccccc2)c2ccccc2)c2ccccc21.
What is the InChIKey of 3-(diphenylphosphorylmethyl)-1-prop-2-enyl-2,3-dihydroindole?
The InChIKey is USZJAUYINREPHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24NOP/c1-2-17-25-18-20(23-15-9-10-16-24(23)25)19-27(26,21-11-5-3-6-12-21)22-13-7-4-8-14-22/h2-16,20H,1,17-19H2.
What are the key properties of 3-(diphenylphosphorylmethyl)-1-prop-2-enyl-2,3-dihydroindole?
3-(diphenylphosphorylmethyl)-1-prop-2-enyl-2,3-dihydroindole has a molecular weight of 373.44 g/mol, XLogP of 4.79, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(diphenylphosphorylmethyl)-1-prop-2-enyl-2,3-dihydroindole is sourced from PubChem (CID 11090057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).