C19H38N2O3S — CID 11090097
(2R)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-2-[(2S)-2-hydroxy-3-sulfanylpropyl]nonanamide (PubChem CID 11090097) has the molecular formula C19H38N2O3S and a molecular weight of 374.59 g/mol. Its IUPAC name is (2R)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-2-[(2S)-2-hydroxy-3-sulfanylpropyl]nonanamide.
| Compound Name | (2R)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-2-[(2S)-2-hydroxy-3-sulfanylpropyl]nonanamide |
|---|---|
| PubChem CID | 11090097 |
| Molecular Formula | C19H38N2O3S |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | (2R)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-2-[(2S)-2-hydroxy-3-sulfanylpropyl]nonanamide |
| SMILES | CCCCCCCC(C[C@H](O)CS)C(=O)N[C@H](C(=O)NC)C(C)(C)C |
| InChI | InChI=1S/C19H38N2O3S/c1-6-7-8-9-10-11-14(12-15(22)13-25)17(23)21-16(18(24)20-5)19(2,3)4/h14-16,22,25H,6-13H2,1-5H3,(H,20,24)(H,21,23)/t14?,15-,16+/m0/s1 |
| InChIKey | PNKICJSNJYXQOE-MERJSTESSA-N |
| XLogP | 2.92 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|