C22H34O3Si — CID 11090098
(4aR,4bR,10aS)-9-[tert-butyl(dimethyl)silyl]oxy-3,4a-dimethyl-5,6,7,8,10,10a-hexahydro-4bH-phenanthrene-1,4-dione (PubChem CID 11090098) has the molecular formula C22H34O3Si and a molecular weight of 374.60 g/mol. Its IUPAC name is (4aR,4bR,10aS)-9-[tert-butyl(dimethyl)silyl]oxy-3,4a-dimethyl-5,6,7,8,10,10a-hexahydro-4bH-phenanthrene-1,4-dione.
| Compound Name | (4aR,4bR,10aS)-9-[tert-butyl(dimethyl)silyl]oxy-3,4a-dimethyl-5,6,7,8,10,10a-hexahydro-4bH-phenanthrene-1,4-dione |
|---|---|
| PubChem CID | 11090098 |
| Molecular Formula | C22H34O3Si |
| Molecular Weight | 374.60 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | (4aR,4bR,10aS)-9-[tert-butyl(dimethyl)silyl]oxy-3,4a-dimethyl-5,6,7,8,10,10a-hexahydro-4bH-phenanthrene-1,4-dione |
| SMILES | CC1=CC(=O)[C@H]2CC(O[Si](C)(C)C(C)(C)C)=C3CCCC[C@H]3[C@@]2(C)C1=O |
| InChI | InChI=1S/C22H34O3Si/c1-14-12-18(23)17-13-19(25-26(6,7)21(2,3)4)15-10-8-9-11-16(15)22(17,5)20(14)24/h12,16-17H,8-11,13H2,1-7H3/t16-,17-,22-/m1/s1 |
| InChIKey | VNUKHOYGWHGJJD-DRSNIGMVSA-N |
| XLogP | 5.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.60 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|