C22H21N3O3 — CID 11090110
(1S,2R,3R,6R,7S,8R)-6-methyl-11-phenyl-3-prop-2-enyl-9,11,13-triazapentacyclo[6.5.2.02,6.02,7.09,13]pentadec-14-ene-5,10,12-trione (PubChem CID 11090110) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is (1S,2R,3R,6R,7S,8R)-6-methyl-11-phenyl-3-prop-2-enyl-9,11,13-triazapentacyclo[6.5.2.02,6.02,7.09,13]pentadec-14-ene-5,10,12-trione.
| Compound Name | (1S,2R,3R,6R,7S,8R)-6-methyl-11-phenyl-3-prop-2-enyl-9,11,13-triazapentacyclo[6.5.2.02,6.02,7.09,13]pentadec-14-ene-5,10,12-trione |
|---|---|
| PubChem CID | 11090110 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | (1S,2R,3R,6R,7S,8R)-6-methyl-11-phenyl-3-prop-2-enyl-9,11,13-triazapentacyclo[6.5.2.02,6.02,7.09,13]pentadec-14-ene-5,10,12-trione |
| SMILES | C=CC[C@@H]1CC(=O)[C@]2(C)[C@H]3[C@H]4C=C[C@H](n5c(=O)n(-c6ccccc6)c(=O)n54)[C@]132 |
| InChI | InChI=1S/C22H21N3O3/c1-3-7-13-12-17(26)21(2)18-15-10-11-16(22(13,18)21)25-20(28)23(19(27)24(15)25)14-8-5-4-6-9-14/h3-6,8-11,13,15-16,18H,1,7,12H2,2H3/t13-,15-,16+,18-,21-,22-/m1/s1 |
| InChIKey | VQXOTVKRPMEFBR-VTXYWVLESA-N |
| XLogP | 2.25 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|