C21H38O4Si — CID 11090253
(3S,3aS,6R,6aR,8S,9S,9aS,9bS)-8-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-3,6,9-trimethyl-3,3a,4,5,6a,7,8,9,9a,9b-decahydroazuleno[4,5-b]furan-2-one (PubChem CID 11090253) has the molecular formula C21H38O4Si and a molecular weight of 382.62 g/mol. Its IUPAC name is (3S,3aS,6R,6aR,8S,9S,9aS,9bS)-8-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-3,6,9-trimethyl-3,3a,4,5,6a,7,8,9,9a,9b-decahydroazuleno[4,5-b]furan-2-one.
| Compound Name | (3S,3aS,6R,6aR,8S,9S,9aS,9bS)-8-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-3,6,9-trimethyl-3,3a,4,5,6a,7,8,9,9a,9b-decahydroazuleno[4,5-b]furan-2-one |
|---|---|
| PubChem CID | 11090253 |
| Molecular Formula | C21H38O4Si |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | (3S,3aS,6R,6aR,8S,9S,9aS,9bS)-8-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-3,6,9-trimethyl-3,3a,4,5,6a,7,8,9,9a,9b-decahydroazuleno[4,5-b]furan-2-one |
| SMILES | C[C@H]1[C@@H]2[C@H]3OC(=O)[C@@H](C)[C@@H]3CC[C@@](C)(O)[C@@H]2C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38O4Si/c1-12-14-9-10-21(6,23)15-11-16(25-26(7,8)20(3,4)5)13(2)17(15)18(14)24-19(12)22/h12-18,23H,9-11H2,1-8H3/t12-,13+,14-,15+,16-,17-,18-,21+/m0/s1 |
| InChIKey | YQKPAXXHCNTRST-NACXYNGLSA-N |
| XLogP | 4.37 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|