C19H32O6Si — CID 11090298
methyl (1aR,4R,4aR,8S,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-8-methyl-5-oxo-1a,2,3,4,6,7-hexahydronaphtho[1,8a-b]oxirene-4a-carboxylate (PubChem CID 11090298) has the molecular formula C19H32O6Si and a molecular weight of 384.55 g/mol. Its IUPAC name is methyl (1aR,4R,4aR,8S,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-8-methyl-5-oxo-1a,2,3,4,6,7-hexahydronaphtho[1,8a-b]oxirene-4a-carboxylate.
| Compound Name | methyl (1aR,4R,4aR,8S,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-8-methyl-5-oxo-1a,2,3,4,6,7-hexahydronaphtho[1,8a-b]oxirene-4a-carboxylate |
|---|---|
| PubChem CID | 11090298 |
| Molecular Formula | C19H32O6Si |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | methyl (1aR,4R,4aR,8S,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-8-methyl-5-oxo-1a,2,3,4,6,7-hexahydronaphtho[1,8a-b]oxirene-4a-carboxylate |
| SMILES | COC(=O)[C@@]12C(=O)CC[C@](C)(O)[C@]13O[C@@H]3CC[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H32O6Si/c1-16(2,3)26(6,7)25-13-8-9-14-19(24-14)17(4,22)11-10-12(20)18(13,19)15(21)23-5/h13-14,22H,8-11H2,1-7H3/t13-,14-,17+,18+,19+/m1/s1 |
| InChIKey | YBVWTMFYLOEMOY-CUDZTTRCSA-N |
| XLogP | 2.58 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|