C20H23N3O5 — CID 11090307
5-[4-(dimethylamino)phenyl]-2-(3,4,5-trimethoxyphenyl)-2H-1,3,4-oxadiazole-3-carbaldehyde (PubChem CID 11090307) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is 5-[4-(dimethylamino)phenyl]-2-(3,4,5-trimethoxyphenyl)-2H-1,3,4-oxadiazole-3-carbaldehyde.
| Compound Name | 5-[4-(dimethylamino)phenyl]-2-(3,4,5-trimethoxyphenyl)-2H-1,3,4-oxadiazole-3-carbaldehyde |
|---|---|
| PubChem CID | 11090307 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 5-[4-(dimethylamino)phenyl]-2-(3,4,5-trimethoxyphenyl)-2H-1,3,4-oxadiazole-3-carbaldehyde |
| SMILES | COc1cc(C2OC(c3ccc(N(C)C)cc3)=NN2C=O)cc(OC)c1OC |
| InChI | InChI=1S/C20H23N3O5/c1-22(2)15-8-6-13(7-9-15)19-21-23(12-24)20(28-19)14-10-16(25-3)18(27-5)17(11-14)26-4/h6-12,20H,1-5H3 |
| InChIKey | BZCCYVICHARQHK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 72.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|