C18H20ClNO3 — CID 110904498
2-(4-chlorophenyl)-N-[2-hydroxy-3-(3-methylphenoxy)propyl]acetamide (PubChem CID 110904498) has the molecular formula C18H20ClNO3 and a molecular weight of 333.82 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[2-hydroxy-3-(3-methylphenoxy)propyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[2-hydroxy-3-(3-methylphenoxy)propyl]acetamide |
|---|---|
| PubChem CID | 110904498 |
| Molecular Formula | C18H20ClNO3 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[2-hydroxy-3-(3-methylphenoxy)propyl]acetamide |
| SMILES | Cc1cccc(OCC(O)CNC(=O)Cc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C18H20ClNO3/c1-13-3-2-4-17(9-13)23-12-16(21)11-20-18(22)10-14-5-7-15(19)8-6-14/h2-9,16,21H,10-12H2,1H3,(H,20,22) |
| InChIKey | MQQKXKDHXXCAEI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |