C17H25F2NO3 — CID 110905199
1-[[1-[4-(difluoromethoxy)-3-methoxyphenyl]ethylamino]methyl]cyclohexan-1-ol (PubChem CID 110905199) has the molecular formula C17H25F2NO3 and a molecular weight of 329.39 g/mol. Its IUPAC name is 1-[[1-[4-(difluoromethoxy)-3-methoxyphenyl]ethylamino]methyl]cyclohexan-1-ol.
| Compound Name | 1-[[1-[4-(difluoromethoxy)-3-methoxyphenyl]ethylamino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 110905199 |
| Molecular Formula | C17H25F2NO3 |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | 1-[[1-[4-(difluoromethoxy)-3-methoxyphenyl]ethylamino]methyl]cyclohexan-1-ol |
| SMILES | COc1cc(C(C)NCC2(O)CCCCC2)ccc1OC(F)F |
| InChI | InChI=1S/C17H25F2NO3/c1-12(20-11-17(21)8-4-3-5-9-17)13-6-7-14(23-16(18)19)15(10-13)22-2/h6-7,10,12,16,20-21H,3-5,8-9,11H2,1-2H3 |
| InChIKey | OKRSGVRMWQFHRI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |