C17H24F3NO2 — CID 110905336
1-[methyl(3,3,3-trifluoropropyl)amino]-3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propan-2-ol (PubChem CID 110905336) has the molecular formula C17H24F3NO2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 1-[methyl(3,3,3-trifluoropropyl)amino]-3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propan-2-ol.
| Compound Name | 1-[methyl(3,3,3-trifluoropropyl)amino]-3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propan-2-ol |
|---|---|
| PubChem CID | 110905336 |
| Molecular Formula | C17H24F3NO2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 1-[methyl(3,3,3-trifluoropropyl)amino]-3-(1,2,3,4-tetrahydronaphthalen-1-yloxy)propan-2-ol |
| SMILES | CN(CCC(F)(F)F)CC(O)COC1CCCc2ccccc21 |
| InChI | InChI=1S/C17H24F3NO2/c1-21(10-9-17(18,19)20)11-14(22)12-23-16-8-4-6-13-5-2-3-7-15(13)16/h2-3,5,7,14,16,22H,4,6,8-12H2,1H3 |
| InChIKey | JEARMWFDAVGXIE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |