C23H42O3Si — CID 11090534
[(E)-5-[(1R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpent-2-enyl] acetate (PubChem CID 11090534) has the molecular formula C23H42O3Si and a molecular weight of 394.67 g/mol. Its IUPAC name is [(E)-5-[(1R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpent-2-enyl] acetate.
| Compound Name | [(E)-5-[(1R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpent-2-enyl] acetate |
|---|---|
| PubChem CID | 11090534 |
| Molecular Formula | C23H42O3Si |
| Molecular Weight | 394.67 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | [(E)-5-[(1R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpent-2-enyl] acetate |
| SMILES | C=C1CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)[C@@H]1CC/C(C)=C/COC(C)=O |
| InChI | InChI=1S/C23H42O3Si/c1-17(15-16-25-19(3)24)11-13-20-18(2)12-14-21(23(20,7)8)26-27(9,10)22(4,5)6/h15,20-21H,2,11-14,16H2,1,3-10H3/b17-15+/t20-,21+/m1/s1 |
| InChIKey | GOIDTYXHLDKJKM-MRUCNHBDSA-N |
| XLogP | 6.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.67 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|